CAS 185457-33-4 is the registry number for Dimethyl 5-aminoisophthalate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Dimethyl 5-aminobenzene-1,3-dicarboxylate;hydrochloride (CAS 185457-33-4) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: dimethyl 5-aminobenzene-1,3-dicarboxylate;hydrochloride. InChIKey: BITSMTARJGEBFK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | dimethyl 5-aminobenzene-1,3-dicarboxylate;hydrochloride |
| InChIKey | BITSMTARJGEBFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)