CAS 92878-95-0 is the registry number for Bosutinib Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-chloropropoxy)-1-methoxy-4-nitrobenzene (CAS 92878-95-0) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: 2-(3-chloropropoxy)-1-methoxy-4-nitrobenzene. InChIKey: JHFBALWBVABSLF-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO4 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | 2-(3-chloropropoxy)-1-methoxy-4-nitrobenzene |
| InChIKey | JHFBALWBVABSLF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])OCCCCl |
Computed by PubChem (NCBI)