Products 464931-62-2
CAS 464931-62-2 appears in our catalog under these names: (R)-3-Amino-3-(benzo[d][1,3]dioxol-5-yl)propanoic acid hydrochloride, 95%, (R)–3–Amino–3–(benzo(d)(1，3)dioxol–5–yl)propanoic acid hydrochloride, (R)-3-Amino-3-(benzo[d][1,3]dioxol-5-yl)propanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
(3R)-3-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride (CAS 464931-62-2) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: (3R)-3-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride. InChIKey: LDMXUXCAMZBRKT-OGFXRTJISA-N.
| Molecular formula | C10H12ClNO4 |
|---|---|
| Molecular weight | 245.66 g/mol |
| IUPAC name | (3R)-3-amino-3-(1,3-benzodioxol-5-yl)propanoic acid;hydrochloride |
| InChIKey | LDMXUXCAMZBRKT-OGFXRTJISA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)