Products 2287279-96-1

CAS 2287279-96-1 is the registry number for 1,3-Dimethyl 4-aminobenzene-1,3-dicarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 4-aminobenzene-1,3-dicarboxylate;hydrochloride (CAS 2287279-96-1) is a chemical compound with the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. IUPAC name: dimethyl 4-aminobenzene-1,3-dicarboxylate;hydrochloride. InChIKey: CKMVFRSFMMWLSZ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClNO4
Molecular weight245.66 g/mol
IUPAC namedimethyl 4-aminobenzene-1,3-dicarboxylate;hydrochloride
InChIKeyCKMVFRSFMMWLSZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)N)C(=O)OC.Cl

Computed by PubChem (NCBI)