CAS 185556-57-4 is the registry number for 2-Hydrazinyl-5-methoxybenzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,025g, 0,05g, 0,1g, 0,5g, 0,25g.
2-hydrazinyl-5-methoxybenzoic acid;hydrochloride (CAS 185556-57-4) is a chemical compound with the molecular formula C8H11ClN2O3 and a molecular weight of 218.64 g/mol. IUPAC name: 2-hydrazinyl-5-methoxybenzoic acid;hydrochloride. InChIKey: NUWUMNXJFGJOKY-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O3 |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-hydrazinyl-5-methoxybenzoic acid;hydrochloride |
| InChIKey | NUWUMNXJFGJOKY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)NN)C(=O)O.Cl |
Computed by PubChem (NCBI)