Products 1855907-10-6

CAS 1855907-10-6 is the registry number for 4-Amino-1-(propan-2-yl)-1H-pyrazole-5-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-amino-1-propan-2-ylpyrazole-5-carboxylic acid;hydrochloride (CAS 1855907-10-6) is a chemical compound with the molecular formula C7H12ClN3O2 and a molecular weight of 205.64 g/mol. IUPAC name: 4-amino-1-propan-2-ylpyrazole-5-carboxylic acid;hydrochloride. InChIKey: MTGJFNJMLDGWOT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClN3O2
Molecular weight205.64 g/mol
IUPAC name4-amino-1-propan-2-ylpyrazole-5-carboxylic acid;hydrochloride
InChIKeyMTGJFNJMLDGWOT-UHFFFAOYSA-N
SMILESCC(C)N1C(=C(C=N1)N)C(=O)O.Cl

Computed by PubChem (NCBI)