CAS 1856518-82-5 is the registry number for 1-(3,4,5-trifluorophenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3,4,5-trifluorophenyl)cyclobutan-1-ol (CAS 1856518-82-5) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1-(3,4,5-trifluorophenyl)cyclobutan-1-ol. InChIKey: REABLXKMNNJJEW-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1-(3,4,5-trifluorophenyl)cyclobutan-1-ol |
| InChIKey | REABLXKMNNJJEW-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=C(C(=C2)F)F)F)O |
Computed by PubChem (NCBI)