Products 1856691-64-9
CAS 1856691-64-9 is the registry number for 2-[(1-Methyl-1H-pyrazol-4-yl)oxy]-5-thiazolecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(1-methylpyrazol-4-yl)oxy-1,3-thiazole-5-carboxylic acid (CAS 1856691-64-9) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: 2-(1-methylpyrazol-4-yl)oxy-1,3-thiazole-5-carboxylic acid. InChIKey: GAZVXJAWFPWPSC-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3S |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | 2-(1-methylpyrazol-4-yl)oxy-1,3-thiazole-5-carboxylic acid |
| InChIKey | GAZVXJAWFPWPSC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)OC2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)