Products 54968-79-5

CAS 54968-79-5 is the registry number for Ethyl 7-oxo-6H,7H-(1,2)thiazolo(4,3-d)pyrimidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 7-oxo-6H-[1,2]thiazolo[4,3-d]pyrimidine-3-carboxylate (CAS 54968-79-5) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: ethyl 7-oxo-6H-[1,2]thiazolo[4,3-d]pyrimidine-3-carboxylate. InChIKey: WZNXAPOURYLMKA-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O3S
Molecular weight225.23 g/mol
IUPAC nameethyl 7-oxo-6H-[1,2]thiazolo[4,3-d]pyrimidine-3-carboxylate
InChIKeyWZNXAPOURYLMKA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2C(=NS1)C(=O)NC=N2

Computed by PubChem (NCBI)