Products 915920-97-7

CAS 915920-97-7 is the registry number for 5-[(4H-1,2,4-Triazol-3-ylthio)methyl]-2-furoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxylic acid (CAS 915920-97-7) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: 5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxylic acid. InChIKey: GNWPFJRHXNYZJV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7N3O3S
Molecular weight225.23 g/mol
IUPAC name5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)furan-2-carboxylic acid
InChIKeyGNWPFJRHXNYZJV-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CSC2=NC=NN2

Computed by PubChem (NCBI)