Products 263385-59-7
CAS 263385-59-7 is the registry number for 3-Methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazole-4-carboxylic acid. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazole-4-carboxylic acid (CAS 263385-59-7) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: 3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazole-4-carboxylic acid. InChIKey: FEZZINWSOIDPDN-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3S |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | 3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | FEZZINWSOIDPDN-UHFFFAOYSA-N |
| SMILES | CC1=C(SN=N1)C2=C(C(=NO2)C)C(=O)O |
Computed by PubChem (NCBI)