Products 1152874-08-2
CAS 1152874-08-2 is the registry number for 2,3-Dihydro-1-benzofuran-5-sulfonyl azide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-diazo-2,3-dihydro-1-benzofuran-5-sulfonamide (CAS 1152874-08-2) is a chemical compound with the molecular formula C8H7N3O3S and a molecular weight of 225.23 g/mol. IUPAC name: N-diazo-2,3-dihydro-1-benzofuran-5-sulfonamide. InChIKey: KOEZLXZQPXXDQB-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3S |
|---|---|
| Molecular weight | 225.23 g/mol |
| IUPAC name | N-diazo-2,3-dihydro-1-benzofuran-5-sulfonamide |
| InChIKey | KOEZLXZQPXXDQB-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)S(=O)(=O)N=[N+]=[N-] |
Computed by PubChem (NCBI)