CAS 1858240-65-9 appears in our catalog under these names: 3-Isopropyl-5-methylaniline hydrochloride, 95%, 3-Isopropyl-5-methylaniline hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g.
3-methyl-5-propan-2-ylaniline;hydrochloride (CAS 1858240-65-9) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: 3-methyl-5-propan-2-ylaniline;hydrochloride. InChIKey: ZUHJYJIYANUJOS-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | 3-methyl-5-propan-2-ylaniline;hydrochloride |
| InChIKey | ZUHJYJIYANUJOS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N)C(C)C.Cl |
Computed by PubChem (NCBI)