CAS 1858241-00-5 is the registry number for Ethyl 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylate (CAS 1858241-00-5) is a chemical compound with the molecular formula C14H13NO5S and a molecular weight of 307.32 g/mol. IUPAC name: ethyl 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: DYIFJWVCEFFCIL-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5S |
|---|---|
| Molecular weight | 307.32 g/mol |
| IUPAC name | ethyl 2-(1,3-benzodioxol-5-yloxy)-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | DYIFJWVCEFFCIL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)OC2=CC3=C(C=C2)OCO3)C |
Computed by PubChem (NCBI)