Products 18738-58-4
CAS 18738-58-4 appears in our catalog under these names: 4-((4-Methoxyphenyl)sulfamoyl)benzoic acid, 4-(4-Methoxy-phenylsulfamoyl)-benzoic acid, 95%, 4-(N-(4-Methoxyphenyl)sulfamoyl)benzoic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
4-[(4-methoxyphenyl)sulfamoyl]benzoic acid (CAS 18738-58-4) is a chemical compound with the molecular formula C14H13NO5S and a molecular weight of 307.32 g/mol. IUPAC name: 4-[(4-methoxyphenyl)sulfamoyl]benzoic acid. InChIKey: LZKUCYPSKRMZOU-UHFFFAOYSA-N.
| Molecular formula | C14H13NO5S |
|---|---|
| Molecular weight | 307.32 g/mol |
| IUPAC name | 4-[(4-methoxyphenyl)sulfamoyl]benzoic acid |
| InChIKey | LZKUCYPSKRMZOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)