CAS 503827-51-8 appears in our catalog under these names: 4-[4-(2,4-Dioxothiazolidin-5-ylidenemethyl)phenoxy]butyric acid, 95%, 4-(4-(2,4-Dioxothiazolidin-5-ylidenemethyl)phenoxy)butyric acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg.
4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid (CAS 503827-51-8) is a chemical compound with the molecular formula C14H13NO5S and a molecular weight of 307.32 g/mol. IUPAC name: 4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid. InChIKey: OCONLCUTYNWJGK-DHZHZOJOSA-N.
| Molecular formula | C14H13NO5S |
|---|---|
| Molecular weight | 307.32 g/mol |
| IUPAC name | 4-[4-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]butanoic acid |
| InChIKey | OCONLCUTYNWJGK-DHZHZOJOSA-N |
| SMILES | C1=CC(=CC=C1/C=C/2\C(=O)NC(=O)S2)OCCCC(=O)O |
Computed by PubChem (NCBI)