Products 78775-31-2

CAS 78775-31-2 is the registry number for 2-Hydroxy-4-((4-methylphenyl)sulfonamido)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-hydroxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid (CAS 78775-31-2) is a chemical compound with the molecular formula C14H13NO5S and a molecular weight of 307.32 g/mol. IUPAC name: 2-hydroxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid. InChIKey: BWGCGJXMTHGWJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO5S
Molecular weight307.32 g/mol
IUPAC name2-hydroxy-4-[(4-methylphenyl)sulfonylamino]benzoic acid
InChIKeyBWGCGJXMTHGWJJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)NC2=CC(=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)