Products 1858256-28-6
CAS 1858256-28-6 is the registry number for 2-Azido-1-(2-methyl-1H-indol-3-yl)ethanone. Offered by: Biosynth. Available pack sizes: 0,5g, 0,05g.
2-azido-1-(2-methyl-1H-indol-3-yl)ethanone (CAS 1858256-28-6) is a chemical compound with the molecular formula C11H10N4O and a molecular weight of 214.22 g/mol. IUPAC name: 2-azido-1-(2-methyl-1H-indol-3-yl)ethanone. InChIKey: QABBFDPMMPHKCK-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-azido-1-(2-methyl-1H-indol-3-yl)ethanone |
| InChIKey | QABBFDPMMPHKCK-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(=O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)