Products 1859083-82-1
CAS 1859083-82-1 appears in our catalog under these names: Methyl 5-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)picolinate, 97%, (5-AMINO-2-(METHOXYCARBONYL)PYRIDIN-4-YL)BORONIC ACID PINACOL ESTER, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg, 5g, 10g, 25g.
Methyl 5-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate (CAS 1859083-82-1) is a chemical compound with the molecular formula C13H19BN2O4 and a molecular weight of 278.11 g/mol. IUPAC name: methyl 5-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate. InChIKey: DJQQWXWLMZMFED-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O4 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | methyl 5-amino-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine-2-carboxylate |
| InChIKey | DJQQWXWLMZMFED-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2N)C(=O)OC |
Computed by PubChem (NCBI)