Products 1859990-59-2
CAS 1859990-59-2 is the registry number for 3-(7-Hydroxy-2-oxo-2H-chromen-3-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid (CAS 1859990-59-2) is a chemical compound with the molecular formula C12H10O5 and a molecular weight of 234.20 g/mol. IUPAC name: 3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid. InChIKey: FBXYNMKDABFEMQ-UHFFFAOYSA-N.
| Molecular formula | C12H10O5 |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 3-(7-hydroxy-2-oxochromen-3-yl)propanoic acid |
| InChIKey | FBXYNMKDABFEMQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(=O)C(=C2)CCC(=O)O |
Computed by PubChem (NCBI)