CAS 1860377-23-6 is the registry number for 3-((4-Amino-1-methyl-1H-pyrazol-3-yl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-N-(1,1-dioxothietan-3-yl)-1-methylpyrazole-3,4-diamine (CAS 1860377-23-6) is a chemical compound with the molecular formula C7H12N4O2S and a molecular weight of 216.26 g/mol. IUPAC name: 3-N-(1,1-dioxothietan-3-yl)-1-methylpyrazole-3,4-diamine. InChIKey: XXTYXHUOWQKHAX-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 3-N-(1,1-dioxothietan-3-yl)-1-methylpyrazole-3,4-diamine |
| InChIKey | XXTYXHUOWQKHAX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)NC2CS(=O)(=O)C2)N |
Computed by PubChem (NCBI)