CAS 627836-81-1 is the registry number for 6-Hydrazinyl-N,N-dimethylpyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-hydrazinyl-N,N-dimethylpyridine-3-sulfonamide (CAS 627836-81-1) is a chemical compound with the molecular formula C7H12N4O2S and a molecular weight of 216.26 g/mol. IUPAC name: 6-hydrazinyl-N,N-dimethylpyridine-3-sulfonamide. InChIKey: GYHBVHHXVVZKJL-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 6-hydrazinyl-N,N-dimethylpyridine-3-sulfonamide |
| InChIKey | GYHBVHHXVVZKJL-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CN=C(C=C1)NN |
Computed by PubChem (NCBI)