CAS 2289603-29-6 is the registry number for 5-(Methylsulfonyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-amine (CAS 2289603-29-6) is a chemical compound with the molecular formula C7H12N4O2S and a molecular weight of 216.26 g/mol. IUPAC name: 5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-amine. InChIKey: JZRKNTQBVLYAQD-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-amine |
| InChIKey | JZRKNTQBVLYAQD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN2C(=C(C=N2)N)C1 |
Computed by PubChem (NCBI)