CAS 202460-51-3 is the registry number for 6-((2-Aminoethyl)amino)pyridine-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
6-(2-aminoethylamino)pyridine-3-sulfonamide (CAS 202460-51-3) is a chemical compound with the molecular formula C7H12N4O2S and a molecular weight of 216.26 g/mol. IUPAC name: 6-(2-aminoethylamino)pyridine-3-sulfonamide. InChIKey: NBONKAUTOVDNNT-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O2S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 6-(2-aminoethylamino)pyridine-3-sulfonamide |
| InChIKey | NBONKAUTOVDNNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1S(=O)(=O)N)NCCN |
Computed by PubChem (NCBI)