CAS 18605-40-8 appears in our catalog under these names: Apomorphine o-Quinone, >95% (HPLC), Apomorphine o-Quinone (6a,7-Didehydroaporphine-10,11-dione). Offered by: TRC, Mikromol, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 10mg.
10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione (CAS 18605-40-8) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: 10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione. InChIKey: DZZIOGKZAPZOCK-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | 10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),5,8,13(17),14-hexaene-3,4-dione |
| InChIKey | DZZIOGKZAPZOCK-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C3C1=CC4=C(C3=CC=C2)C(=O)C(=O)C=C4 |
Computed by PubChem (NCBI)