Products 1860791-28-1
CAS 1860791-28-1 is the registry number for Entacapone Impurity 73. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate (CAS 1860791-28-1) is a chemical compound with the molecular formula C13H12N2O6 and a molecular weight of 292.24 g/mol. IUPAC name: propan-2-yl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate. InChIKey: SHRHRGWKYFBDQK-YCRREMRBSA-N.
| Molecular formula | C13H12N2O6 |
|---|---|
| Molecular weight | 292.24 g/mol |
| IUPAC name | propan-2-yl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate |
| InChIKey | SHRHRGWKYFBDQK-YCRREMRBSA-N |
| SMILES | CC(C)OC(=O)/C(=C/C1=CC(=C(C(=C1)O)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)