CAS 892293-14-0 is the registry number for 4-(6,8-Dioxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinazolin-7(6h)-yl)butanoic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoic acid (CAS 892293-14-0) is a chemical compound with the molecular formula C13H12N2O6 and a molecular weight of 292.24 g/mol. IUPAC name: 4-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoic acid. InChIKey: NFVMLPMTMHSYSH-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O6 |
|---|---|
| Molecular weight | 292.24 g/mol |
| IUPAC name | 4-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)butanoic acid |
| InChIKey | NFVMLPMTMHSYSH-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=O)N(C(=O)N3)CCCC(=O)O |
Computed by PubChem (NCBI)