CAS 521286-72-6 is the registry number for methyl 4–(1–cyano–2–ethoxy–2–oxoethyl)–3–nitrobenzoate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Methyl 3-(1-cyano-2-ethoxy-2-oxoethyl)-4-nitrobenzoate (CAS 521286-72-6) is a chemical compound with the molecular formula C13H12N2O6 and a molecular weight of 292.24 g/mol. IUPAC name: methyl 3-(1-cyano-2-ethoxy-2-oxoethyl)-4-nitrobenzoate. InChIKey: FVTAXBMBJAWJIE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O6 |
|---|---|
| Molecular weight | 292.24 g/mol |
| IUPAC name | methyl 3-(1-cyano-2-ethoxy-2-oxoethyl)-4-nitrobenzoate |
| InChIKey | FVTAXBMBJAWJIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)