Products 18658-36-1
CAS 18658-36-1 is the registry number for (4-amino-1,3-dioxoisoindolin-2-yl)glutamic acid. Offered by: TRC. Available pack sizes: 750mg.
2-(4-amino-1,3-dioxoisoindol-2-yl)pentanedioic acid (CAS 18658-36-1) is a chemical compound with the molecular formula C13H12N2O6 and a molecular weight of 292.24 g/mol. IUPAC name: 2-(4-amino-1,3-dioxoisoindol-2-yl)pentanedioic acid. InChIKey: KQOKYLBWODYVIR-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O6 |
|---|---|
| Molecular weight | 292.24 g/mol |
| IUPAC name | 2-(4-amino-1,3-dioxoisoindol-2-yl)pentanedioic acid |
| InChIKey | KQOKYLBWODYVIR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)N(C2=O)C(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)