CAS 1860918-07-5 is the registry number for 3-(1H-Indol-7-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1H-indol-7-yl)aniline (CAS 1860918-07-5) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 3-(1H-indol-7-yl)aniline. InChIKey: UESHSQHYYTYFLE-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 3-(1H-indol-7-yl)aniline |
| InChIKey | UESHSQHYYTYFLE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C3=CC(=CC=C3)N)NC=C2 |
Computed by PubChem (NCBI)