Products 18621-77-7
CAS 18621-77-7 appears in our catalog under these names: 2-Butene-1,4-dimethacrylate, 98%, But-2-ene-1,4-diyl bis(2-methylacrylate), 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
[(E)-4-(2-methylprop-2-enoyloxy)but-2-enyl] 2-methylprop-2-enoate (CAS 18621-77-7) is a chemical compound with the molecular formula C12H16O4 and a molecular weight of 224.25 g/mol. IUPAC name: [(E)-4-(2-methylprop-2-enoyloxy)but-2-enyl] 2-methylprop-2-enoate. InChIKey: SNPKTIBMZOAVGQ-AATRIKPKSA-N.
| Molecular formula | C12H16O4 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | [(E)-4-(2-methylprop-2-enoyloxy)but-2-enyl] 2-methylprop-2-enoate |
| InChIKey | SNPKTIBMZOAVGQ-AATRIKPKSA-N |
| SMILES | CC(=C)C(=O)OC/C=C/COC(=O)C(=C)C |
Computed by PubChem (NCBI)