CAS 1862177-86-3 is the registry number for COB-187, 95.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg, 100 mg.
4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione (CAS 1862177-86-3) is a chemical compound with the molecular formula C15H14N2OS2 and a molecular weight of 302.4 g/mol. IUPAC name: 4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione. InChIKey: RPAZLTQZYXMTQP-UHFFFAOYSA-N.
| Molecular formula | C15H14N2OS2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione |
| InChIKey | RPAZLTQZYXMTQP-UHFFFAOYSA-N |
| SMILES | C1C(N(C(=S)S1)CC2=CC=NC=C2)(C3=CC=CC=C3)O |
Computed by PubChem (NCBI)