Products 1862177-86-3

CAS 1862177-86-3 is the registry number for COB-187, 95.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg, 100 mg.

Structural formula: {0} (CAS {1})

4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione (CAS 1862177-86-3) is a chemical compound with the molecular formula C15H14N2OS2 and a molecular weight of 302.4 g/mol. IUPAC name: 4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione. InChIKey: RPAZLTQZYXMTQP-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2OS2
Molecular weight302.4 g/mol
IUPAC name4-hydroxy-4-phenyl-3-(pyridin-4-ylmethyl)-1,3-thiazolidine-2-thione
InChIKeyRPAZLTQZYXMTQP-UHFFFAOYSA-N
SMILESC1C(N(C(=S)S1)CC2=CC=NC=C2)(C3=CC=CC=C3)O

Computed by PubChem (NCBI)

Synonyms: orb2646381