CAS 59898-65-6 is the registry number for 2-Mercapto-5,6-dimethyl-3-(p-tolyl)thieno[2,3-d]pyrimidin-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,6-dimethyl-3-(4-methylphenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 59898-65-6) is a chemical compound with the molecular formula C15H14N2OS2 and a molecular weight of 302.4 g/mol. IUPAC name: 5,6-dimethyl-3-(4-methylphenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: WMASTILJZKYNKN-UHFFFAOYSA-N.
| Molecular formula | C15H14N2OS2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 5,6-dimethyl-3-(4-methylphenyl)-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | WMASTILJZKYNKN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C3=C(NC2=S)SC(=C3C)C |
Computed by PubChem (NCBI)