Products 852933-45-0
CAS 852933-45-0 is the registry number for 3-Ethyl-5-methyl-6-phenyl-2-sulfanyl-3H,4H-thieno(2,3-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-ethyl-5-methyl-6-phenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 852933-45-0) is a chemical compound with the molecular formula C15H14N2OS2 and a molecular weight of 302.4 g/mol. IUPAC name: 3-ethyl-5-methyl-6-phenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: FEEDJVIEAUEBGD-UHFFFAOYSA-N.
| Molecular formula | C15H14N2OS2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 3-ethyl-5-methyl-6-phenyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | FEEDJVIEAUEBGD-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(NC1=S)SC(=C2C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)