Products 875286-88-7
CAS 875286-88-7 is the registry number for Rorγ activator 1b. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide (CAS 875286-88-7) is a chemical compound with the molecular formula C15H14N2OS2 and a molecular weight of 302.4 g/mol. IUPAC name: N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide. InChIKey: GSHQRYRMPNCEPF-UHFFFAOYSA-N.
| Molecular formula | C15H14N2OS2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide |
| InChIKey | GSHQRYRMPNCEPF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=C1)C(=O)NC2=NC3=C(C=C(C=C3S2)C)C |
Computed by PubChem (NCBI)