CAS 186320-22-9 appears in our catalog under these names: a-(Fmoc-amino)-cyclohexaneacetic acid, 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclohexylacetic acid, Fmoc-DL-cHex-Gly-OH 95%, 2-cyclohexyl-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}acetic acid, 98%, 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-cyclohexylacetic acid, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g.
2-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 186320-22-9) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: 2-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: BWQQGHPODCJZDB-UHFFFAOYSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-cyclohexyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | BWQQGHPODCJZDB-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)