CAS 1863671-44-6 is the registry number for 3-[(2,3-Dichlorophenoxy)methyl]azetidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[(2,3-dichlorophenoxy)methyl]azetidine (CAS 1863671-44-6) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 3-[(2,3-dichlorophenoxy)methyl]azetidine. InChIKey: PRZKITABMSJNJK-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 3-[(2,3-dichlorophenoxy)methyl]azetidine |
| InChIKey | PRZKITABMSJNJK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)COC2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)