CAS 186390-62-5 appears in our catalog under these names: 7–Bromo–6–nitro–1,2,3,4–tetrahydroisoquinoline, 7-Bromo-6-nitro-1,2,3,4-tetrahydroisoquinoline, 95%, 95%, 7-Bromo-6-nitro-1,2,3,4-tetrahydroisoquinoline, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-bromo-6-nitro-1,2,3,4-tetrahydroisoquinoline (CAS 186390-62-5) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: 7-bromo-6-nitro-1,2,3,4-tetrahydroisoquinoline. InChIKey: MLIZUKAIRKGUIM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 7-bromo-6-nitro-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | MLIZUKAIRKGUIM-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)