CAS 1864003-42-8 is the registry number for 1-((1S,2R)-2-Ethoxy-4-oxocyclobutyl)pyrrolidine-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(1S,2R)-2-ethoxy-4-oxocyclobutyl]pyrrolidine-2,5-dione (CAS 1864003-42-8) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: 1-[(1S,2R)-2-ethoxy-4-oxocyclobutyl]pyrrolidine-2,5-dione. InChIKey: KQEMIMMWSSBDCV-GMSGAONNSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | 1-[(1S,2R)-2-ethoxy-4-oxocyclobutyl]pyrrolidine-2,5-dione |
| InChIKey | KQEMIMMWSSBDCV-GMSGAONNSA-N |
| SMILES | CCO[C@@H]1CC(=O)[C@H]1N2C(=O)CCC2=O |
Computed by PubChem (NCBI)