CAS 1864058-49-0 appears in our catalog under these names: 5,6,7-Trifluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 96%, 5,6,7-Trifluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 5,6,7-Trifluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 96%, 96%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 50mg, 100mg.
5,6,7-trifluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1864058-49-0) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: 5,6,7-trifluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: VBYFXZPVKSQSTG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | 5,6,7-trifluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | VBYFXZPVKSQSTG-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C(=C2C1N)F)F)F.Cl |
Computed by PubChem (NCBI)