CAS 1864073-68-6 is the registry number for 2-Amino-4,6-dichloropyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride (CAS 1864073-68-6) is a chemical compound with the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.5 g/mol. IUPAC name: 2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride. InChIKey: SLMKWZDYCGXROL-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O2 |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | 2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride |
| InChIKey | SLMKWZDYCGXROL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)N)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)