Products 1864073-68-6

CAS 1864073-68-6 is the registry number for 2-Amino-4,6-dichloropyridine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride (CAS 1864073-68-6) is a chemical compound with the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.5 g/mol. IUPAC name: 2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride. InChIKey: SLMKWZDYCGXROL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl3N2O2
Molecular weight243.5 g/mol
IUPAC name2-amino-4,6-dichloropyridine-3-carboxylic acid;hydrochloride
InChIKeySLMKWZDYCGXROL-UHFFFAOYSA-N
SMILESC1=C(C(=C(N=C1Cl)N)C(=O)O)Cl.Cl

Computed by PubChem (NCBI)