CAS 70737-50-7 is the registry number for 1-(2,2,2-Trichloroethoxycarbonyl)-1H-imidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,2,2-trichloroethyl imidazole-1-carboxylate (CAS 70737-50-7) is a chemical compound with the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.5 g/mol. IUPAC name: 2,2,2-trichloroethyl imidazole-1-carboxylate. InChIKey: FZPFFJOICMDOSY-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O2 |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | 2,2,2-trichloroethyl imidazole-1-carboxylate |
| InChIKey | FZPFFJOICMDOSY-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=O)OCC(Cl)(Cl)Cl |
Computed by PubChem (NCBI)