CAS 2241130-14-1 is the registry number for 4-Amino-2,6-dichloronicotinic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g.
4-amino-2,6-dichloropyridine-3-carboxylic acid;hydrochloride (CAS 2241130-14-1) is a chemical compound with the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.5 g/mol. IUPAC name: 4-amino-2,6-dichloropyridine-3-carboxylic acid;hydrochloride. InChIKey: CZTVYNXTOTVUIW-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O2 |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | 4-amino-2,6-dichloropyridine-3-carboxylic acid;hydrochloride |
| InChIKey | CZTVYNXTOTVUIW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C(=O)O)N.Cl |
Computed by PubChem (NCBI)