CAS 349637-08-7 is the registry number for 2,2,2-Trichloro-N-(5-methylisoxazol-3-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trichloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide (CAS 349637-08-7) is a chemical compound with the molecular formula C6H5Cl3N2O2 and a molecular weight of 243.5 g/mol. IUPAC name: 2,2,2-trichloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide. InChIKey: YNPJNHVZTVCDOL-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl3N2O2 |
|---|---|
| Molecular weight | 243.5 g/mol |
| IUPAC name | 2,2,2-trichloro-N-(5-methyl-1,2-oxazol-3-yl)acetamide |
| InChIKey | YNPJNHVZTVCDOL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)NC(=O)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)