Products 186584-74-7
CAS 186584-74-7 appears in our catalog under these names: 3-(Benzyloxy)-5-fluorobenzoic acid, 98%, 3-(Benzyloxy)-5-fluorobenzoic acid, ≥99.4%, ≥99.4%, 3-(Benzyloxy)-5-fluorobenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
3-fluoro-5-phenylmethoxybenzoic acid (CAS 186584-74-7) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-fluoro-5-phenylmethoxybenzoic acid. InChIKey: HVZBXDHNZDYNAS-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-fluoro-5-phenylmethoxybenzoic acid |
| InChIKey | HVZBXDHNZDYNAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)