CAS 186700-05-0 is the registry number for 2-(3-Chlorophenoxy)-benzylamine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
[2-(3-chlorophenoxy)phenyl]methanamine (CAS 186700-05-0) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: [2-(3-chlorophenoxy)phenyl]methanamine. InChIKey: NFGQBPIHFSNZTB-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | [2-(3-chlorophenoxy)phenyl]methanamine |
| InChIKey | NFGQBPIHFSNZTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)OC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)