Products 1867790-58-6
CAS 1867790-58-6 is the registry number for rel-(3R,5S)-3,4,5-Trimethylpiperazine-1-sulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-3,4,5-trimethylpiperazine-1-sulfonyl chloride (CAS 1867790-58-6) is a chemical compound with the molecular formula C7H15ClN2O2S and a molecular weight of 226.73 g/mol. IUPAC name: (3R,5S)-3,4,5-trimethylpiperazine-1-sulfonyl chloride. InChIKey: GVQZBMIMOKJXHP-KNVOCYPGSA-N.
| Molecular formula | C7H15ClN2O2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (3R,5S)-3,4,5-trimethylpiperazine-1-sulfonyl chloride |
| InChIKey | GVQZBMIMOKJXHP-KNVOCYPGSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)