CAS 2214271-35-7 is the registry number for 8-(Methylsulfonyl)-3,8-diazabicyclo[3.2.1]octane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane;hydrochloride (CAS 2214271-35-7) is a chemical compound with the molecular formula C7H15ClN2O2S and a molecular weight of 226.73 g/mol. IUPAC name: 8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane;hydrochloride. InChIKey: MRFDUCHDMLFGMB-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | 8-methylsulfonyl-3,8-diazabicyclo[3.2.1]octane;hydrochloride |
| InChIKey | MRFDUCHDMLFGMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1C2CCC1CNC2.Cl |
Computed by PubChem (NCBI)