CAS 2177264-50-3 is the registry number for CIS-5-METHANESULFONYL-OCTAHYDROPYRROLO(2,3-C)PYRROLE HCL, 97%. Offered by: AmBeed. Available pack sizes: 10g, 1g, 5g.
(3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride (CAS 2177264-50-3) is a chemical compound with the molecular formula C7H15ClN2O2S and a molecular weight of 226.73 g/mol. IUPAC name: (3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride. InChIKey: SPLMACVQGFEUJR-UOERWJHTSA-N.
| Molecular formula | C7H15ClN2O2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | (3aS,6aS)-5-methylsulfonyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrole;hydrochloride |
| InChIKey | SPLMACVQGFEUJR-UOERWJHTSA-N |
| SMILES | CS(=O)(=O)N1C[C@@H]2CCN[C@@H]2C1.Cl |
Computed by PubChem (NCBI)