CAS 2937878-17-4 is the registry number for N-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-methyl-methanesulfonamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-methylmethanesulfonamide;hydrochloride (CAS 2937878-17-4) is a chemical compound with the molecular formula C7H15ClN2O2S and a molecular weight of 226.73 g/mol. IUPAC name: N-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-methylmethanesulfonamide;hydrochloride. InChIKey: GGBYAPGJTIMYLL-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O2S |
|---|---|
| Molecular weight | 226.73 g/mol |
| IUPAC name | N-(3-amino-1-bicyclo[1.1.1]pentanyl)-N-methylmethanesulfonamide;hydrochloride |
| InChIKey | GGBYAPGJTIMYLL-UHFFFAOYSA-N |
| SMILES | CN(C12CC(C1)(C2)N)S(=O)(=O)C.Cl |
Computed by PubChem (NCBI)